C13H20Cl2NO7P — CID 70582118
2-[phenylmethoxycarbonyl(phosphonomethyl)amino]butanoic acid;dihydrochloride (PubChem CID 70582118) has the molecular formula C13H20Cl2NO7P and a molecular weight of 404.18 g/mol. Its IUPAC name is 2-[phenylmethoxycarbonyl(phosphonomethyl)amino]butanoic acid;dihydrochloride.
| Compound Name | 2-[phenylmethoxycarbonyl(phosphonomethyl)amino]butanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 70582118 |
| Molecular Formula | C13H20Cl2NO7P |
| Molecular Weight | 404.18 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 2-[phenylmethoxycarbonyl(phosphonomethyl)amino]butanoic acid;dihydrochloride |
| SMILES | CCC(C(=O)O)N(CP(=O)(O)O)C(=O)OCc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C13H18NO7P.2ClH/c1-2-11(12(15)16)14(9-22(18,19)20)13(17)21-8-10-6-4-3-5-7-10;;/h3-7,11H,2,8-9H2,1H3,(H,15,16)(H2,18,19,20);2*1H |
| InChIKey | UCMOXNBOHLXUEG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.18 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|