C15H19NO5S — CID 101207738
(4S)-5-methoxy-4-[methyl(phenylmethoxycarbonyl)amino]-5-oxopentanethioic S-acid (PubChem CID 101207738) has the molecular formula C15H19NO5S and a molecular weight of 325.39 g/mol. Its IUPAC name is (4S)-5-methoxy-4-[methyl(phenylmethoxycarbonyl)amino]-5-oxopentanethioic S-acid.
| Compound Name | (4S)-5-methoxy-4-[methyl(phenylmethoxycarbonyl)amino]-5-oxopentanethioic S-acid |
|---|---|
| PubChem CID | 101207738 |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (4S)-5-methoxy-4-[methyl(phenylmethoxycarbonyl)amino]-5-oxopentanethioic S-acid |
| SMILES | COC(=O)[C@H](CCC(=O)S)N(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H19NO5S/c1-16(12(14(18)20-2)8-9-13(17)22)15(19)21-10-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3,(H,17,22)/t12-/m0/s1 |
| InChIKey | AKBJZMSYBSZLCY-LBPRGKRZSA-N |
| XLogP | 2.03 |
| TPSA | 72.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|