C26H40N4O8 — CID 12012207
methyl (2S)-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-[methyl(phenylmethoxycarbonyl)amino]pentanoate (PubChem CID 12012207) has the molecular formula C26H40N4O8 and a molecular weight of 536.63 g/mol. Its IUPAC name is methyl (2S)-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-[methyl(phenylmethoxycarbonyl)amino]pentanoate.
| Compound Name | methyl (2S)-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-[methyl(phenylmethoxycarbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 12012207 |
| Molecular Formula | C26H40N4O8 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | methyl (2S)-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-[methyl(phenylmethoxycarbonyl)amino]pentanoate |
| SMILES | COC(=O)[C@H](CCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)N(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H40N4O8/c1-25(2,3)37-22(32)28-21(29-23(33)38-26(4,5)6)27-16-12-15-19(20(31)35-8)30(7)24(34)36-17-18-13-10-9-11-14-18/h9-11,13-14,19H,12,15-17H2,1-8H3,(H2,27,28,29,32,33)/t19-/m0/s1 |
| InChIKey | YWTFXEKSJMSTJV-IBGZPJMESA-N |
| XLogP | 3.98 |
| TPSA | 144.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|