C29H47N5O7 — CID 54060467
benzyl N-[2-[8-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]octylamino]-2-oxoethyl]carbamate (PubChem CID 54060467) has the molecular formula C29H47N5O7 and a molecular weight of 577.72 g/mol. Its IUPAC name is benzyl N-[2-[8-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]octylamino]-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-[8-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]octylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 54060467 |
| Molecular Formula | C29H47N5O7 |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.35 |
| IUPAC Name | benzyl N-[2-[8-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]octylamino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCCCCCCNC(=O)CNC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H47N5O7/c1-28(2,3)40-26(37)33-24(34-27(38)41-29(4,5)6)31-19-15-10-8-7-9-14-18-30-23(35)20-32-25(36)39-21-22-16-12-11-13-17-22/h11-13,16-17H,7-10,14-15,18-21H2,1-6H3,(H,30,35)(H,32,36)(H2,31,33,34,37,38) |
| InChIKey | LZIPOIUVFPDZCQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 156.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|