C21H38N4O8 — CID 10576480
4-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-hydroxy-4-oxobutanoic acid (PubChem CID 10576480) has the molecular formula C21H38N4O8 and a molecular weight of 474.56 g/mol. Its IUPAC name is 4-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-hydroxy-4-oxobutanoic acid.
| Compound Name | 4-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-hydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 10576480 |
| Molecular Formula | C21H38N4O8 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | 4-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-hydroxy-4-oxobutanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCCCCNC(=O)CC(O)C(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H38N4O8/c1-20(2,3)32-18(30)24-17(25-19(31)33-21(4,5)6)23-12-10-8-7-9-11-22-15(27)13-14(26)16(28)29/h14,26H,7-13H2,1-6H3,(H,22,27)(H,28,29)(H2,23,24,25,30,31) |
| InChIKey | GOZVQVGOHCENCH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 175.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|