C33H64N8O8 — CID 54021204
tert-butyl N-[4-[4-[[2-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-oxoethyl]carbamoylamino]butylamino]butan-2-yl]carbamate (PubChem CID 54021204) has the molecular formula C33H64N8O8 and a molecular weight of 700.92 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[[2-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-oxoethyl]carbamoylamino]butylamino]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[[2-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-oxoethyl]carbamoylamino]butylamino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 54021204 |
| Molecular Formula | C33H64N8O8 |
| Molecular Weight | 700.92 g/mol |
| Exact Mass | 700.48 |
| IUPAC Name | tert-butyl N-[4-[4-[[2-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-oxoethyl]carbamoylamino]butylamino]butan-2-yl]carbamate |
| SMILES | CC(CCNCCCCNC(=O)NCC(=O)NCCCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H64N8O8/c1-24(39-28(44)47-31(2,3)4)17-22-34-18-15-16-21-37-27(43)38-23-25(42)35-19-13-11-12-14-20-36-26(40-29(45)48-32(5,6)7)41-30(46)49-33(8,9)10/h24,34H,11-23H2,1-10H3,(H,35,42)(H,39,44)(H2,37,38,43)(H2,36,40,41,45,46) |
| InChIKey | KZAXOOLAFGDZBE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 209.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.92 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|