C39H74N8O10 — CID 54405748
tert-butyl N-[4-[[2-[8-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]octylamino]-2-oxoethyl]carbamoylamino]butyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate (PubChem CID 54405748) has the molecular formula C39H74N8O10 and a molecular weight of 815.07 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-[8-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]octylamino]-2-oxoethyl]carbamoylamino]butyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[4-[[2-[8-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]octylamino]-2-oxoethyl]carbamoylamino]butyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
|---|---|
| PubChem CID | 54405748 |
| Molecular Formula | C39H74N8O10 |
| Molecular Weight | 815.07 g/mol |
| Exact Mass | 814.55 |
| IUPAC Name | tert-butyl N-[4-[[2-[8-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]octylamino]-2-oxoethyl]carbamoylamino]butyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCN(CCCCNC(=O)NCC(=O)NCCCCCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C39H74N8O10/c1-36(2,3)54-32(50)43-25-21-27-47(35(53)57-39(10,11)12)26-20-19-24-42-31(49)44-28-29(48)40-22-17-15-13-14-16-18-23-41-30(45-33(51)55-37(4,5)6)46-34(52)56-38(7,8)9/h13-28H2,1-12H3,(H,40,48)(H,43,50)(H2,42,44,49)(H2,41,45,46,51,52) |
| InChIKey | VQNRFWZZMWCGFW-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 227.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 57 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.07 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|