C29H57N7O7 — CID 88644804
tert-butyl N-[4-[[(2S)-2-[7-(diaminomethylideneamino)heptanoylamino]-4-hydroxybutanoyl]amino]butyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate (PubChem CID 88644804) has the molecular formula C29H57N7O7 and a molecular weight of 615.82 g/mol. Its IUPAC name is tert-butyl N-[4-[[(2S)-2-[7-(diaminomethylideneamino)heptanoylamino]-4-hydroxybutanoyl]amino]butyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[4-[[(2S)-2-[7-(diaminomethylideneamino)heptanoylamino]-4-hydroxybutanoyl]amino]butyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
|---|---|
| PubChem CID | 88644804 |
| Molecular Formula | C29H57N7O7 |
| Molecular Weight | 615.82 g/mol |
| Exact Mass | 615.43 |
| IUPAC Name | tert-butyl N-[4-[[(2S)-2-[7-(diaminomethylideneamino)heptanoylamino]-4-hydroxybutanoyl]amino]butyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCN(CCCCNC(=O)[C@H](CCO)NC(=O)CCCCCCN=C(N)N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H57N7O7/c1-28(2,3)42-26(40)34-18-13-20-36(27(41)43-29(4,5)6)19-12-11-16-32-24(39)22(15-21-37)35-23(38)14-9-7-8-10-17-33-25(30)31/h22,37H,7-21H2,1-6H3,(H,32,39)(H,34,40)(H,35,38)(H4,30,31,33)/t22-/m0/s1 |
| InChIKey | YFQNUJYVHPESJI-QFIPXVFZSA-N |
| XLogP | 2.13 |
| TPSA | 210.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.82 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|