C29H48N4O8 — CID 70492707
tert-butyl N-[4-[[(2S)-4-hydroxy-2-(phenylmethoxycarbonylamino)butanoyl]amino]butyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate (PubChem CID 70492707) has the molecular formula C29H48N4O8 and a molecular weight of 580.72 g/mol. Its IUPAC name is tert-butyl N-[4-[[(2S)-4-hydroxy-2-(phenylmethoxycarbonylamino)butanoyl]amino]butyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[4-[[(2S)-4-hydroxy-2-(phenylmethoxycarbonylamino)butanoyl]amino]butyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
|---|---|
| PubChem CID | 70492707 |
| Molecular Formula | C29H48N4O8 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.35 |
| IUPAC Name | tert-butyl N-[4-[[(2S)-4-hydroxy-2-(phenylmethoxycarbonylamino)butanoyl]amino]butyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCN(CCCCNC(=O)[C@H](CCO)NC(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H48N4O8/c1-28(2,3)40-25(36)31-17-12-19-33(27(38)41-29(4,5)6)18-11-10-16-30-24(35)23(15-20-34)32-26(37)39-21-22-13-8-7-9-14-22/h7-9,13-14,23,34H,10-12,15-21H2,1-6H3,(H,30,35)(H,31,36)(H,32,37)/t23-/m0/s1 |
| InChIKey | JNMGEJAREWAOHQ-QHCPKHFHSA-N |
| XLogP | 3.71 |
| TPSA | 155.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|