C36H69N7O11S — CID 10629201
tert-butyl N-[4-[[2-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-oxoethyl]sulfonylamino]butyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate (PubChem CID 10629201) has the molecular formula C36H69N7O11S and a molecular weight of 808.05 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-oxoethyl]sulfonylamino]butyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[4-[[2-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-oxoethyl]sulfonylamino]butyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
|---|---|
| PubChem CID | 10629201 |
| Molecular Formula | C36H69N7O11S |
| Molecular Weight | 808.05 g/mol |
| Exact Mass | 807.48 |
| IUPAC Name | tert-butyl N-[4-[[2-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-oxoethyl]sulfonylamino]butyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCN(CCCCNS(=O)(=O)CC(=O)NCCCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H69N7O11S/c1-33(2,3)51-29(45)39-22-19-25-43(32(48)54-36(10,11)12)24-18-17-23-40-55(49,50)26-27(44)37-20-15-13-14-16-21-38-28(41-30(46)52-34(4,5)6)42-31(47)53-35(7,8)9/h40H,13-26H2,1-12H3,(H,37,44)(H,39,45)(H2,38,41,42,46,47) |
| InChIKey | DZRNWDJOLCHEOT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 232.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.05 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|