C17H35N3O4 — CID 130174309
tert-butyl N-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]butylamino]propyl]carbamate (PubChem CID 130174309) has the molecular formula C17H35N3O4 and a molecular weight of 345.48 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]butylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]butylamino]propyl]carbamate |
|---|---|
| PubChem CID | 130174309 |
| Molecular Formula | C17H35N3O4 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.26 |
| IUPAC Name | tert-butyl N-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]butylamino]propyl]carbamate |
| SMILES | CC(CCNCCCNC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H35N3O4/c1-13(20-15(22)24-17(5,6)7)9-12-18-10-8-11-19-14(21)23-16(2,3)4/h13,18H,8-12H2,1-7H3,(H,19,21)(H,20,22) |
| InChIKey | HKHWPCAPBWKWSG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|