C24H44N4O8 — CID 157408081
(2S)-7-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid (PubChem CID 157408081) has the molecular formula C24H44N4O8 and a molecular weight of 516.64 g/mol. Its IUPAC name is (2S)-7-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid.
| Compound Name | (2S)-7-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid |
|---|---|
| PubChem CID | 157408081 |
| Molecular Formula | C24H44N4O8 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | (2S)-7-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid |
| SMILES | CC(CCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)[C@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C24H44N4O8/c1-15(16(17(29)30)26-19(31)34-22(2,3)4)13-11-12-14-25-18(27-20(32)35-23(5,6)7)28-21(33)36-24(8,9)10/h15-16H,11-14H2,1-10H3,(H,26,31)(H,29,30)(H2,25,27,28,32,33)/t15?,16-/m0/s1 |
| InChIKey | BNYMZYBMUKDRAQ-LYKKTTPLSA-N |
| XLogP | 4.18 |
| TPSA | 164.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|