C17H31N3O6 — CID 59630575
6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexanoic acid (PubChem CID 59630575) has the molecular formula C17H31N3O6 and a molecular weight of 373.45 g/mol. Its IUPAC name is 6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexanoic acid.
| Compound Name | 6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexanoic acid |
|---|---|
| PubChem CID | 59630575 |
| Molecular Formula | C17H31N3O6 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCCCC(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H31N3O6/c1-16(2,3)25-14(23)19-13(20-15(24)26-17(4,5)6)18-11-9-7-8-10-12(21)22/h7-11H2,1-6H3,(H,21,22)(H2,18,19,20,23,24) |
| InChIKey | SJUBEIUCRUAHTK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|