C21H40N4O7 — CID 135325014
tert-butyl N-[(1S)-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-1-hydroxypentyl]carbamate (PubChem CID 135325014) has the molecular formula C21H40N4O7 and a molecular weight of 460.57 g/mol. Its IUPAC name is tert-butyl N-[(1S)-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-1-hydroxypentyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-1-hydroxypentyl]carbamate |
|---|---|
| PubChem CID | 135325014 |
| Molecular Formula | C21H40N4O7 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.29 |
| IUPAC Name | tert-butyl N-[(1S)-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-1-hydroxypentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCC[C@H](O)NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H40N4O7/c1-19(2,3)30-16(27)23-14(26)12-10-11-13-22-15(24-17(28)31-20(4,5)6)25-18(29)32-21(7,8)9/h14,26H,10-13H2,1-9H3,(H,23,27)(H2,22,24,25,28,29)/t14-/m0/s1 |
| InChIKey | VTTOJSSZRKQVGG-AWEZNQCLSA-N |
| XLogP | 3.41 |
| TPSA | 147.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|