C25H45N5O8 — CID 134214298
tert-butyl N-[(2S)-6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-1-oxo-1-(3-oxopropylamino)hexan-2-yl]carbamate (PubChem CID 134214298) has the molecular formula C25H45N5O8 and a molecular weight of 543.66 g/mol. Its IUPAC name is tert-butyl N-[(2S)-6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-1-oxo-1-(3-oxopropylamino)hexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-1-oxo-1-(3-oxopropylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 134214298 |
| Molecular Formula | C25H45N5O8 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.33 |
| IUPAC Name | tert-butyl N-[(2S)-6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-1-oxo-1-(3-oxopropylamino)hexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)NCCC=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H45N5O8/c1-23(2,3)36-20(33)28-17(18(32)26-15-12-16-31)13-10-11-14-27-19(29-21(34)37-24(4,5)6)30-22(35)38-25(7,8)9/h16-17H,10-15H2,1-9H3,(H,26,32)(H,28,33)(H2,27,29,30,34,35)/t17-/m0/s1 |
| InChIKey | VHTJTMUUVQBURU-KRWDZBQOSA-N |
| XLogP | 3.16 |
| TPSA | 173.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|