C13H25N3O4S — CID 57211692
tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(2-sulfanylethyl)carbamimidoyl]carbamate (PubChem CID 57211692) has the molecular formula C13H25N3O4S and a molecular weight of 319.43 g/mol. Its IUPAC name is tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(2-sulfanylethyl)carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(2-sulfanylethyl)carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 57211692 |
| Molecular Formula | C13H25N3O4S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(2-sulfanylethyl)carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=NCCS)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25N3O4S/c1-12(2,3)19-10(17)15-9(14-7-8-21)16-11(18)20-13(4,5)6/h21H,7-8H2,1-6H3,(H2,14,15,16,17,18) |
| InChIKey | JJYLIFYLXOAQEJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|