C34H56N6O8 — CID 144860216
tert-butyl N-[4-[4-[7-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]heptylamino]-4-oxobutoxy]benzenecarboximidoyl]carbamate (PubChem CID 144860216) has the molecular formula C34H56N6O8 and a molecular weight of 676.86 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[7-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]heptylamino]-4-oxobutoxy]benzenecarboximidoyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[7-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]heptylamino]-4-oxobutoxy]benzenecarboximidoyl]carbamate |
|---|---|
| PubChem CID | 144860216 |
| Molecular Formula | C34H56N6O8 |
| Molecular Weight | 676.86 g/mol |
| Exact Mass | 676.42 |
| IUPAC Name | tert-butyl N-[4-[4-[7-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]heptylamino]-4-oxobutoxy]benzenecarboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)c1ccc(OCCCC(=O)NCCCCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C34H56N6O8/c1-32(2,3)46-29(42)38-27(35)24-17-19-25(20-18-24)45-23-15-16-26(41)36-21-13-11-10-12-14-22-37-28(39-30(43)47-33(4,5)6)40-31(44)48-34(7,8)9/h17-20H,10-16,21-23H2,1-9H3,(H,36,41)(H2,35,38,42)(H2,37,39,40,43,44) |
| InChIKey | GSPLODGWQIMIBO-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 189.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.86 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|