C20H34N6O2 — CID 118151587
4-(4-carbamimidoylphenoxy)-N-[8-(diaminomethylideneamino)octyl]butanamide (PubChem CID 118151587) has the molecular formula C20H34N6O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 4-(4-carbamimidoylphenoxy)-N-[8-(diaminomethylideneamino)octyl]butanamide.
| Compound Name | 4-(4-carbamimidoylphenoxy)-N-[8-(diaminomethylideneamino)octyl]butanamide |
|---|---|
| PubChem CID | 118151587 |
| Molecular Formula | C20H34N6O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | 4-(4-carbamimidoylphenoxy)-N-[8-(diaminomethylideneamino)octyl]butanamide |
| SMILES | [H]/N=C(\N)c1ccc(OCCCC(=O)NCCCCCCCCN=C(N)N)cc1 |
| InChI | InChI=1S/C20H34N6O2/c21-19(22)16-9-11-17(12-10-16)28-15-7-8-18(27)25-13-5-3-1-2-4-6-14-26-20(23)24/h9-12H,1-8,13-15H2,(H3,21,22)(H,25,27)(H4,23,24,26) |
| InChIKey | PVJCQGBEQWWYLX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 152.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|