C16H26ClN3O3 — CID 67131778
6-[3-(4-carbamimidoylphenoxy)propylamino]hexanoic acid;hydrochloride (PubChem CID 67131778) has the molecular formula C16H26ClN3O3 and a molecular weight of 343.85 g/mol. Its IUPAC name is 6-[3-(4-carbamimidoylphenoxy)propylamino]hexanoic acid;hydrochloride.
| Compound Name | 6-[3-(4-carbamimidoylphenoxy)propylamino]hexanoic acid;hydrochloride |
|---|---|
| PubChem CID | 67131778 |
| Molecular Formula | C16H26ClN3O3 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 6-[3-(4-carbamimidoylphenoxy)propylamino]hexanoic acid;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(OCCCNCCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C16H25N3O3.ClH/c17-16(18)13-6-8-14(9-7-13)22-12-4-11-19-10-3-1-2-5-15(20)21;/h6-9,19H,1-5,10-12H2,(H3,17,18)(H,20,21);1H |
| InChIKey | WGZJOVQWLLZBAI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 108.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|