C19H26N4O8 — CID 10478278
(3S)-3-[5-(4-carbamimidoylphenoxy)pentanoylamino]-4-[[(1S)-1-carboxy-2-hydroxyethyl]amino]-4-oxobutanoic acid (PubChem CID 10478278) has the molecular formula C19H26N4O8 and a molecular weight of 438.44 g/mol. Its IUPAC name is (3S)-3-[5-(4-carbamimidoylphenoxy)pentanoylamino]-4-[[(1S)-1-carboxy-2-hydroxyethyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[5-(4-carbamimidoylphenoxy)pentanoylamino]-4-[[(1S)-1-carboxy-2-hydroxyethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 10478278 |
| Molecular Formula | C19H26N4O8 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | (3S)-3-[5-(4-carbamimidoylphenoxy)pentanoylamino]-4-[[(1S)-1-carboxy-2-hydroxyethyl]amino]-4-oxobutanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(OCCCCC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)O)cc1 |
| InChI | InChI=1S/C19H26N4O8/c20-17(21)11-4-6-12(7-5-11)31-8-2-1-3-15(25)22-13(9-16(26)27)18(28)23-14(10-24)19(29)30/h4-7,13-14,24H,1-3,8-10H2,(H3,20,21)(H,22,25)(H,23,28)(H,26,27)(H,29,30)/t13-,14-/m0/s1 |
| InChIKey | DBZWVAUGUMRCJB-KBPBESRZSA-N |
| XLogP | -0.96 |
| TPSA | 212.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|