C21H29N5O7 — CID 11754137
(2S)-2-[[(2S)-2-[4-[(4-carbamimidoylbenzoyl)amino]butanoylamino]-3-carboxypropanoyl]amino]-3-methylbutanoic acid (PubChem CID 11754137) has the molecular formula C21H29N5O7 and a molecular weight of 463.49 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[4-[(4-carbamimidoylbenzoyl)amino]butanoylamino]-3-carboxypropanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[4-[(4-carbamimidoylbenzoyl)amino]butanoylamino]-3-carboxypropanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 11754137 |
| Molecular Formula | C21H29N5O7 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | (2S)-2-[[(2S)-2-[4-[(4-carbamimidoylbenzoyl)amino]butanoylamino]-3-carboxypropanoyl]amino]-3-methylbutanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NCCCC(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)O)C(C)C)cc1 |
| InChI | InChI=1S/C21H29N5O7/c1-11(2)17(21(32)33)26-20(31)14(10-16(28)29)25-15(27)4-3-9-24-19(30)13-7-5-12(6-8-13)18(22)23/h5-8,11,14,17H,3-4,9-10H2,1-2H3,(H3,22,23)(H,24,30)(H,25,27)(H,26,31)(H,28,29)(H,32,33)/t14-,17-/m0/s1 |
| InChIKey | FXTHXYZWKCDKBY-YOEHRIQHSA-N |
| XLogP | -0.33 |
| TPSA | 211.77 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|