C16H17N5O3 — CID 19419665
4-[[5-(4-carbamimidoylphenyl)pyrimidine-2-carbonyl]amino]butanoic acid (PubChem CID 19419665) has the molecular formula C16H17N5O3 and a molecular weight of 327.34 g/mol. Its IUPAC name is 4-[[5-(4-carbamimidoylphenyl)pyrimidine-2-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[5-(4-carbamimidoylphenyl)pyrimidine-2-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 19419665 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 4-[[5-(4-carbamimidoylphenyl)pyrimidine-2-carbonyl]amino]butanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(-c2cnc(C(=O)NCCCC(=O)O)nc2)cc1 |
| InChI | InChI=1S/C16H17N5O3/c17-14(18)11-5-3-10(4-6-11)12-8-20-15(21-9-12)16(24)19-7-1-2-13(22)23/h3-6,8-9H,1-2,7H2,(H3,17,18)(H,19,24)(H,22,23) |
| InChIKey | NOYBXCHHKBQZOC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 142.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|