C19H22N8O3 — CID 19921435
3-[[8-(4-carbamimidoylphenyl)-6-(dimethylamino)-7-methylpurine-2-carbonyl]amino]propanoic acid (PubChem CID 19921435) has the molecular formula C19H22N8O3 and a molecular weight of 410.44 g/mol. Its IUPAC name is 3-[[8-(4-carbamimidoylphenyl)-6-(dimethylamino)-7-methylpurine-2-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[8-(4-carbamimidoylphenyl)-6-(dimethylamino)-7-methylpurine-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 19921435 |
| Molecular Formula | C19H22N8O3 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 3-[[8-(4-carbamimidoylphenyl)-6-(dimethylamino)-7-methylpurine-2-carbonyl]amino]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(-c2nc3nc(C(=O)NCCC(=O)O)nc(N(C)C)c3n2C)cc1 |
| InChI | InChI=1S/C19H22N8O3/c1-26(2)18-13-15(23-16(25-18)19(30)22-9-8-12(28)29)24-17(27(13)3)11-6-4-10(5-7-11)14(20)21/h4-7H,8-9H2,1-3H3,(H3,20,21)(H,22,30)(H,28,29) |
| InChIKey | UQBQRGNPVSRNMY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 163.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|