C18H20N8O3 — CID 19921303
methyl 3-[[6-amino-8-(4-carbamimidoylphenyl)-7-methylpurine-2-carbonyl]amino]propanoate (PubChem CID 19921303) has the molecular formula C18H20N8O3 and a molecular weight of 396.41 g/mol. Its IUPAC name is methyl 3-[[6-amino-8-(4-carbamimidoylphenyl)-7-methylpurine-2-carbonyl]amino]propanoate.
| Compound Name | methyl 3-[[6-amino-8-(4-carbamimidoylphenyl)-7-methylpurine-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 19921303 |
| Molecular Formula | C18H20N8O3 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | methyl 3-[[6-amino-8-(4-carbamimidoylphenyl)-7-methylpurine-2-carbonyl]amino]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(-c2nc3nc(C(=O)NCCC(=O)OC)nc(N)c3n2C)cc1 |
| InChI | InChI=1S/C18H20N8O3/c1-26-12-14(21)23-16(18(28)22-8-7-11(27)29-2)24-15(12)25-17(26)10-5-3-9(4-6-10)13(19)20/h3-6H,7-8H2,1-2H3,(H3,19,20)(H,22,28)(H2,21,23,24) |
| InChIKey | OKUUHIBPIGIXGB-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 174.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|