C17H17N7O4 — CID 135548446
3-[[8-(4-carbamimidoylphenyl)-9-methyl-6-oxo-1H-purine-2-carbonyl]amino]propanoic acid (PubChem CID 135548446) has the molecular formula C17H17N7O4 and a molecular weight of 383.37 g/mol. Its IUPAC name is 3-[[8-(4-carbamimidoylphenyl)-9-methyl-6-oxo-1H-purine-2-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[8-(4-carbamimidoylphenyl)-9-methyl-6-oxo-1H-purine-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 135548446 |
| Molecular Formula | C17H17N7O4 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 3-[[8-(4-carbamimidoylphenyl)-9-methyl-6-oxo-1H-purine-2-carbonyl]amino]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(-c2nc3c(=O)[nH]c(C(=O)NCCC(=O)O)nc3n2C)cc1 |
| InChI | InChI=1S/C17H17N7O4/c1-24-14(9-4-2-8(3-5-9)12(18)19)21-11-15(24)22-13(23-16(11)27)17(28)20-7-6-10(25)26/h2-5H,6-7H2,1H3,(H3,18,19)(H,20,28)(H,25,26)(H,22,23,27) |
| InChIKey | YTLRTTOOFSNPTK-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 179.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|