C21H21N5O3 — CID 19921112
3-[[2-(4-carbamimidoylphenyl)-1-prop-2-enylbenzimidazole-5-carbonyl]amino]propanoic acid (PubChem CID 19921112) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is 3-[[2-(4-carbamimidoylphenyl)-1-prop-2-enylbenzimidazole-5-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[2-(4-carbamimidoylphenyl)-1-prop-2-enylbenzimidazole-5-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 19921112 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 3-[[2-(4-carbamimidoylphenyl)-1-prop-2-enylbenzimidazole-5-carbonyl]amino]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(-c2nc3cc(C(=O)NCCC(=O)O)ccc3n2CC=C)cc1 |
| InChI | InChI=1S/C21H21N5O3/c1-2-11-26-17-8-7-15(21(29)24-10-9-18(27)28)12-16(17)25-20(26)14-5-3-13(4-6-14)19(22)23/h2-8,12H,1,9-11H2,(H3,22,23)(H,24,29)(H,27,28) |
| InChIKey | IPPYCMMKUTXGJA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 134.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|