C19H19N5O3 — CID 19921192
3-[[2-(4-carbamimidoylphenyl)-7-methyl-3H-benzimidazole-5-carbonyl]amino]propanoic acid (PubChem CID 19921192) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is 3-[[2-(4-carbamimidoylphenyl)-7-methyl-3H-benzimidazole-5-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[2-(4-carbamimidoylphenyl)-7-methyl-3H-benzimidazole-5-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 19921192 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 3-[[2-(4-carbamimidoylphenyl)-7-methyl-3H-benzimidazole-5-carbonyl]amino]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(-c2nc3c(C)cc(C(=O)NCCC(=O)O)cc3[nH]2)cc1 |
| InChI | InChI=1S/C19H19N5O3/c1-10-8-13(19(27)22-7-6-15(25)26)9-14-16(10)24-18(23-14)12-4-2-11(3-5-12)17(20)21/h2-5,8-9H,6-7H2,1H3,(H3,20,21)(H,22,27)(H,23,24)(H,25,26) |
| InChIKey | XYZLSONLPXLQLQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 144.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|