C23H25N5O4 — CID 11037474
tert-butyl 3-[[3-[5-(4-carbamimidoylphenyl)-1,2,4-oxadiazol-3-yl]benzoyl]amino]propanoate (PubChem CID 11037474) has the molecular formula C23H25N5O4 and a molecular weight of 435.48 g/mol. Its IUPAC name is tert-butyl 3-[[3-[5-(4-carbamimidoylphenyl)-1,2,4-oxadiazol-3-yl]benzoyl]amino]propanoate.
| Compound Name | tert-butyl 3-[[3-[5-(4-carbamimidoylphenyl)-1,2,4-oxadiazol-3-yl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 11037474 |
| Molecular Formula | C23H25N5O4 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | tert-butyl 3-[[3-[5-(4-carbamimidoylphenyl)-1,2,4-oxadiazol-3-yl]benzoyl]amino]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(-c2nc(-c3cccc(C(=O)NCCC(=O)OC(C)(C)C)c3)no2)cc1 |
| InChI | InChI=1S/C23H25N5O4/c1-23(2,3)31-18(29)11-12-26-21(30)17-6-4-5-16(13-17)20-27-22(32-28-20)15-9-7-14(8-10-15)19(24)25/h4-10,13H,11-12H2,1-3H3,(H3,24,25)(H,26,30) |
| InChIKey | PEVFRQHTPWKWAH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 144.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|