C27H36N4O7S — CID 59895987
ditert-butyl (2S)-2-[[3-[(4-carbamimidoylphenyl)carbamoyl]phenyl]sulfonylamino]pentanedioate (PubChem CID 59895987) has the molecular formula C27H36N4O7S and a molecular weight of 560.67 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[3-[(4-carbamimidoylphenyl)carbamoyl]phenyl]sulfonylamino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[3-[(4-carbamimidoylphenyl)carbamoyl]phenyl]sulfonylamino]pentanedioate |
|---|---|
| PubChem CID | 59895987 |
| Molecular Formula | C27H36N4O7S |
| Molecular Weight | 560.67 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | ditert-butyl (2S)-2-[[3-[(4-carbamimidoylphenyl)carbamoyl]phenyl]sulfonylamino]pentanedioate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2cccc(S(=O)(=O)N[C@@H](CCC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C27H36N4O7S/c1-26(2,3)37-22(32)15-14-21(25(34)38-27(4,5)6)31-39(35,36)20-9-7-8-18(16-20)24(33)30-19-12-10-17(11-13-19)23(28)29/h7-13,16,21,31H,14-15H2,1-6H3,(H3,28,29)(H,30,33)/t21-/m0/s1 |
| InChIKey | XRURHCCNDMGZMY-NRFANRHFSA-N |
| XLogP | 3.33 |
| TPSA | 177.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.67 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|