C23H26N4O4 — CID 10550158
tert-butyl 2-[6-[(4-carbamimidoylphenyl)carbamoyl]-1-oxo-3,4-dihydroisoquinolin-2-yl]acetate (PubChem CID 10550158) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is tert-butyl 2-[6-[(4-carbamimidoylphenyl)carbamoyl]-1-oxo-3,4-dihydroisoquinolin-2-yl]acetate.
| Compound Name | tert-butyl 2-[6-[(4-carbamimidoylphenyl)carbamoyl]-1-oxo-3,4-dihydroisoquinolin-2-yl]acetate |
|---|---|
| PubChem CID | 10550158 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | tert-butyl 2-[6-[(4-carbamimidoylphenyl)carbamoyl]-1-oxo-3,4-dihydroisoquinolin-2-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2ccc3c(c2)CCN(CC(=O)OC(C)(C)C)C3=O)cc1 |
| InChI | InChI=1S/C23H26N4O4/c1-23(2,3)31-19(28)13-27-11-10-15-12-16(6-9-18(15)22(27)30)21(29)26-17-7-4-14(5-8-17)20(24)25/h4-9,12H,10-11,13H2,1-3H3,(H3,24,25)(H,26,29) |
| InChIKey | ZRVMLAFPPKKCNG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 125.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|