C19H17FN4O4 — CID 23377828
2-[6-[(4-carbamimidoyl-2-fluorobenzoyl)amino]-1-oxo-3,4-dihydroisoquinolin-2-yl]acetic acid (PubChem CID 23377828) has the molecular formula C19H17FN4O4 and a molecular weight of 384.37 g/mol. Its IUPAC name is 2-[6-[(4-carbamimidoyl-2-fluorobenzoyl)amino]-1-oxo-3,4-dihydroisoquinolin-2-yl]acetic acid.
| Compound Name | 2-[6-[(4-carbamimidoyl-2-fluorobenzoyl)amino]-1-oxo-3,4-dihydroisoquinolin-2-yl]acetic acid |
|---|---|
| PubChem CID | 23377828 |
| Molecular Formula | C19H17FN4O4 |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 2-[6-[(4-carbamimidoyl-2-fluorobenzoyl)amino]-1-oxo-3,4-dihydroisoquinolin-2-yl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)Nc2ccc3c(c2)CCN(CC(=O)O)C3=O)c(F)c1 |
| InChI | InChI=1S/C19H17FN4O4/c20-15-8-11(17(21)22)1-3-14(15)18(27)23-12-2-4-13-10(7-12)5-6-24(19(13)28)9-16(25)26/h1-4,7-8H,5-6,9H2,(H3,21,22)(H,23,27)(H,25,26) |
| InChIKey | CWSTZELIUWPFNF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|