C21H16ClN3O3 — CID 22626426
2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-4-chlorobenzoic acid (PubChem CID 22626426) has the molecular formula C21H16ClN3O3 and a molecular weight of 393.83 g/mol. Its IUPAC name is 2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-4-chlorobenzoic acid.
| Compound Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 22626426 |
| Molecular Formula | C21H16ClN3O3 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-4-chlorobenzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2ccccc2-c2cc(Cl)ccc2C(=O)O)cc1 |
| InChI | InChI=1S/C21H16ClN3O3/c22-13-7-10-17(21(27)28)18(11-13)15-3-1-2-4-16(15)20(26)25-14-8-5-12(6-9-14)19(23)24/h1-11H,(H3,23,24)(H,25,26)(H,27,28) |
| InChIKey | RLWVEYQOWAQNNX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 116.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|