C25H21N3O2 — CID 22626570
2-[3-[(4-carbamimidoylanilino)methyl]naphthalen-2-yl]benzoic acid (PubChem CID 22626570) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-[3-[(4-carbamimidoylanilino)methyl]naphthalen-2-yl]benzoic acid.
| Compound Name | 2-[3-[(4-carbamimidoylanilino)methyl]naphthalen-2-yl]benzoic acid |
|---|---|
| PubChem CID | 22626570 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 2-[3-[(4-carbamimidoylanilino)methyl]naphthalen-2-yl]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NCc2cc3ccccc3cc2-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C25H21N3O2/c26-24(27)16-9-11-20(12-10-16)28-15-19-13-17-5-1-2-6-18(17)14-23(19)21-7-3-4-8-22(21)25(29)30/h1-14,28H,15H2,(H3,26,27)(H,29,30) |
| InChIKey | QDCLDPJMMCMQOA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 99.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|