About hydrazine;4-[(4-phenoxyphenyl)methylamino]benzenecarboximidamide
hydrazine;4-[(4-phenoxyphenyl)methylamino]benzenecarboximidamide (PubChem CID 142938635) has the molecular formula C20H23N5O
and a molecular weight of 349.44 g/mol. Its IUPAC name is hydrazine;4-[(4-phenoxyphenyl)methylamino]benzenecarboximidamide.
Molecular Properties
| Compound Name | hydrazine;4-[(4-phenoxyphenyl)methylamino]benzenecarboximidamide |
| PubChem CID | 142938635 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | hydrazine;4-[(4-phenoxyphenyl)methylamino]benzenecarboximidamide |
| SMILES | NN.[H]/N=C(\N)c1ccc(NCc2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C20H19N3O.H4N2/c21-20(22)16-8-10-17(11-9-16)23-14-15-6-12-19(13-7-15)24-18-4-2-1-3-5-18;1-2/h1-13,23H,14H2,(H3,21,22);1-2H2 |
| InChIKey | FPJOHUGPRCLNQT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 123.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;4-[(4-phenoxyphenyl)methylamino]benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;4-[(4-phenoxyphenyl)methylamino]benzenecarboximidamide?
The IUPAC name of hydrazine;4-[(4-phenoxyphenyl)methylamino]benzenecarboximidamide (CID 142938635) is hydrazine;4-[(4-phenoxyphenyl)methylamino]benzenecarboximidamide.
What is the SMILES notation for hydrazine;4-[(4-phenoxyphenyl)methylamino]benzenecarboximidamide?
The canonical SMILES for hydrazine;4-[(4-phenoxyphenyl)methylamino]benzenecarboximidamide is NN.[H]/N=C(\N)c1ccc(NCc2ccc(Oc3ccccc3)cc2)cc1.
What is the InChIKey of hydrazine;4-[(4-phenoxyphenyl)methylamino]benzenecarboximidamide?
The InChIKey is FPJOHUGPRCLNQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O.H4N2/c21-20(22)16-8-10-17(11-9-16)23-14-15-6-12-19(13-7-15)24-18-4-2-1-3-5-18;1-2/h1-13,23H,14H2,(H3,21,22);1-2H2.
What are the key properties of hydrazine;4-[(4-phenoxyphenyl)methylamino]benzenecarboximidamide?
hydrazine;4-[(4-phenoxyphenyl)methylamino]benzenecarboximidamide has a molecular weight of 349.44 g/mol, XLogP of 3.19, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;4-[(4-phenoxyphenyl)methylamino]benzenecarboximidamide is sourced from PubChem (CID 142938635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).