C23H26N6 — CID 58652724
4-[[3-[[4-(N'-methylcarbamimidoyl)anilino]methyl]phenyl]methylamino]benzenecarboximidamide (PubChem CID 58652724) has the molecular formula C23H26N6 and a molecular weight of 386.50 g/mol. Its IUPAC name is 4-[[3-[[4-(N'-methylcarbamimidoyl)anilino]methyl]phenyl]methylamino]benzenecarboximidamide.
| Compound Name | 4-[[3-[[4-(N'-methylcarbamimidoyl)anilino]methyl]phenyl]methylamino]benzenecarboximidamide |
|---|---|
| PubChem CID | 58652724 |
| Molecular Formula | C23H26N6 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 4-[[3-[[4-(N'-methylcarbamimidoyl)anilino]methyl]phenyl]methylamino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NCc2cccc(CNc3ccc(/C(N)=N/C)cc3)c2)cc1 |
| InChI | InChI=1S/C23H26N6/c1-27-23(26)19-7-11-21(12-8-19)29-15-17-4-2-3-16(13-17)14-28-20-9-5-18(6-10-20)22(24)25/h2-13,28-29H,14-15H2,1H3,(H3,24,25)(H2,26,27) |
| InChIKey | JZFYSVQVLMIYHJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|