C11H12N4S — CID 70094072
4-(1,3-thiazol-2-ylmethylamino)benzenecarboximidamide (PubChem CID 70094072) has the molecular formula C11H12N4S and a molecular weight of 232.31 g/mol. Its IUPAC name is 4-(1,3-thiazol-2-ylmethylamino)benzenecarboximidamide.
| Compound Name | 4-(1,3-thiazol-2-ylmethylamino)benzenecarboximidamide |
|---|---|
| PubChem CID | 70094072 |
| Molecular Formula | C11H12N4S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 4-(1,3-thiazol-2-ylmethylamino)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NCc2nccs2)cc1 |
| InChI | InChI=1S/C11H12N4S/c12-11(13)8-1-3-9(4-2-8)15-7-10-14-5-6-16-10/h1-6,15H,7H2,(H3,12,13) |
| InChIKey | NUSXMVRCHRCVBS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|