C12H13N3OS2 — CID 61300986
4-[2-(1,3-thiazol-2-ylsulfanyl)ethoxy]benzenecarboximidamide (PubChem CID 61300986) has the molecular formula C12H13N3OS2 and a molecular weight of 279.39 g/mol. Its IUPAC name is 4-[2-(1,3-thiazol-2-ylsulfanyl)ethoxy]benzenecarboximidamide.
| Compound Name | 4-[2-(1,3-thiazol-2-ylsulfanyl)ethoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 61300986 |
| Molecular Formula | C12H13N3OS2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 4-[2-(1,3-thiazol-2-ylsulfanyl)ethoxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OCCSc2nccs2)cc1 |
| InChI | InChI=1S/C12H13N3OS2/c13-11(14)9-1-3-10(4-2-9)16-6-8-18-12-15-5-7-17-12/h1-5,7H,6,8H2,(H3,13,14) |
| InChIKey | CXMVNSJZYKASET-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|