C10H9N3S2 — CID 61218361
4-(1,3-thiazol-2-ylsulfanyl)benzenecarboximidamide (PubChem CID 61218361) has the molecular formula C10H9N3S2 and a molecular weight of 235.34 g/mol. Its IUPAC name is 4-(1,3-thiazol-2-ylsulfanyl)benzenecarboximidamide.
| Compound Name | 4-(1,3-thiazol-2-ylsulfanyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 61218361 |
| Molecular Formula | C10H9N3S2 |
| Molecular Weight | 235.34 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 4-(1,3-thiazol-2-ylsulfanyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Sc2nccs2)cc1 |
| InChI | InChI=1S/C10H9N3S2/c11-9(12)7-1-3-8(4-2-7)15-10-13-5-6-14-10/h1-6H,(H3,11,12) |
| InChIKey | JYRQOYZTUBARSP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|