C7H11N3S2 — CID 61219315
3-(1,3-thiazol-2-ylsulfanyl)butanimidamide (PubChem CID 61219315) has the molecular formula C7H11N3S2 and a molecular weight of 201.32 g/mol. Its IUPAC name is 3-(1,3-thiazol-2-ylsulfanyl)butanimidamide.
| Compound Name | 3-(1,3-thiazol-2-ylsulfanyl)butanimidamide |
|---|---|
| PubChem CID | 61219315 |
| Molecular Formula | C7H11N3S2 |
| Molecular Weight | 201.32 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 3-(1,3-thiazol-2-ylsulfanyl)butanimidamide |
| SMILES | [H]/N=C(\N)CC(C)Sc1nccs1 |
| InChI | InChI=1S/C7H11N3S2/c1-5(4-6(8)9)12-7-10-2-3-11-7/h2-3,5H,4H2,1H3,(H3,8,9) |
| InChIKey | YGSZTWDSPUHEEP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|