C8H13N3OS2 — CID 63581257
4-(1,3-thiazol-2-ylsulfanyl)pentanehydrazide (PubChem CID 63581257) has the molecular formula C8H13N3OS2 and a molecular weight of 231.35 g/mol. Its IUPAC name is 4-(1,3-thiazol-2-ylsulfanyl)pentanehydrazide.
| Compound Name | 4-(1,3-thiazol-2-ylsulfanyl)pentanehydrazide |
|---|---|
| PubChem CID | 63581257 |
| Molecular Formula | C8H13N3OS2 |
| Molecular Weight | 231.35 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 4-(1,3-thiazol-2-ylsulfanyl)pentanehydrazide |
| SMILES | CC(CCC(=O)NN)Sc1nccs1 |
| InChI | InChI=1S/C8H13N3OS2/c1-6(2-3-7(12)11-9)14-8-10-4-5-13-8/h4-6H,2-3,9H2,1H3,(H,11,12) |
| InChIKey | RBZXEQRTSJTDOY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|