About 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]pentanehydrazide
4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]pentanehydrazide (PubChem CID 63581838) has the molecular formula C7H14N6OS
and a molecular weight of 230.30 g/mol. Its IUPAC name is 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]pentanehydrazide.
Molecular Properties
| Compound Name | 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]pentanehydrazide |
| PubChem CID | 63581838 |
| Molecular Formula | C7H14N6OS |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]pentanehydrazide |
| SMILES | CC(CCC(=O)NN)Sc1nncn1N |
| InChI | InChI=1S/C7H14N6OS/c1-5(2-3-6(14)11-8)15-7-12-10-4-13(7)9/h4-5H,2-3,8-9H2,1H3,(H,11,14) |
| InChIKey | IBPACPZQKRWUMO-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]pentanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]pentanehydrazide?
The IUPAC name of 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]pentanehydrazide (CID 63581838) is 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]pentanehydrazide.
What is the SMILES notation for 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]pentanehydrazide?
The canonical SMILES for 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]pentanehydrazide is CC(CCC(=O)NN)Sc1nncn1N.
What is the InChIKey of 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]pentanehydrazide?
The InChIKey is IBPACPZQKRWUMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N6OS/c1-5(2-3-6(14)11-8)15-7-12-10-4-13(7)9/h4-5H,2-3,8-9H2,1H3,(H,11,14).
What are the key properties of 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]pentanehydrazide?
4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]pentanehydrazide has a molecular weight of 230.30 g/mol, XLogP of -0.76, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]pentanehydrazide is sourced from PubChem (CID 63581838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).