C11H14N6OS — CID 105352430
2-[4-[(4-amino-1,2,4-triazol-3-yl)sulfanylmethyl]phenyl]acetohydrazide (PubChem CID 105352430) has the molecular formula C11H14N6OS and a molecular weight of 278.34 g/mol. Its IUPAC name is 2-[4-[(4-amino-1,2,4-triazol-3-yl)sulfanylmethyl]phenyl]acetohydrazide.
| Compound Name | 2-[4-[(4-amino-1,2,4-triazol-3-yl)sulfanylmethyl]phenyl]acetohydrazide |
|---|---|
| PubChem CID | 105352430 |
| Molecular Formula | C11H14N6OS |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-[4-[(4-amino-1,2,4-triazol-3-yl)sulfanylmethyl]phenyl]acetohydrazide |
| SMILES | NNC(=O)Cc1ccc(CSc2nncn2N)cc1 |
| InChI | InChI=1S/C11H14N6OS/c12-15-10(18)5-8-1-3-9(4-2-8)6-19-11-16-14-7-17(11)13/h1-4,7H,5-6,12-13H2,(H,15,18) |
| InChIKey | AVYOTZZMVWDNKO-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|