C10H12N6OS — CID 63581836
2-[(4-amino-1,2,4-triazol-3-yl)sulfanylmethyl]benzohydrazide (PubChem CID 63581836) has the molecular formula C10H12N6OS and a molecular weight of 264.31 g/mol. Its IUPAC name is 2-[(4-amino-1,2,4-triazol-3-yl)sulfanylmethyl]benzohydrazide.
| Compound Name | 2-[(4-amino-1,2,4-triazol-3-yl)sulfanylmethyl]benzohydrazide |
|---|---|
| PubChem CID | 63581836 |
| Molecular Formula | C10H12N6OS |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 2-[(4-amino-1,2,4-triazol-3-yl)sulfanylmethyl]benzohydrazide |
| SMILES | NNC(=O)c1ccccc1CSc1nncn1N |
| InChI | InChI=1S/C10H12N6OS/c11-14-9(17)8-4-2-1-3-7(8)5-18-10-15-13-6-16(10)12/h1-4,6H,5,11-12H2,(H,14,17) |
| InChIKey | VNDFBNBINSFFFC-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|