C12H14N4OS2 — CID 63582368
2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanylmethyl]benzohydrazide (PubChem CID 63582368) has the molecular formula C12H14N4OS2 and a molecular weight of 294.41 g/mol. Its IUPAC name is 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanylmethyl]benzohydrazide.
| Compound Name | 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanylmethyl]benzohydrazide |
|---|---|
| PubChem CID | 63582368 |
| Molecular Formula | C12H14N4OS2 |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanylmethyl]benzohydrazide |
| SMILES | Cc1nc(N)sc1SCc1ccccc1C(=O)NN |
| InChI | InChI=1S/C12H14N4OS2/c1-7-11(19-12(13)15-7)18-6-8-4-2-3-5-9(8)10(17)16-14/h2-5H,6,14H2,1H3,(H2,13,15)(H,16,17) |
| InChIKey | JDZBWQWJDIDXOA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|