C12H11N3O4S2 — CID 104825217
2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanylmethyl]-6-nitrobenzoic acid (PubChem CID 104825217) has the molecular formula C12H11N3O4S2 and a molecular weight of 325.37 g/mol. Its IUPAC name is 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanylmethyl]-6-nitrobenzoic acid.
| Compound Name | 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanylmethyl]-6-nitrobenzoic acid |
|---|---|
| PubChem CID | 104825217 |
| Molecular Formula | C12H11N3O4S2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanylmethyl]-6-nitrobenzoic acid |
| SMILES | Cc1nc(N)sc1SCc1cccc([N+](=O)[O-])c1C(=O)O |
| InChI | InChI=1S/C12H11N3O4S2/c1-6-11(21-12(13)14-6)20-5-7-3-2-4-8(15(18)19)9(7)10(16)17/h2-4H,5H2,1H3,(H2,13,14)(H,16,17) |
| InChIKey | QHSYTQXAHYEMMF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 119.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|