C11H8N2O5S — CID 106920733
2-nitro-6-(1,3-oxazol-2-ylsulfanylmethyl)benzoic acid (PubChem CID 106920733) has the molecular formula C11H8N2O5S and a molecular weight of 280.26 g/mol. Its IUPAC name is 2-nitro-6-(1,3-oxazol-2-ylsulfanylmethyl)benzoic acid.
| Compound Name | 2-nitro-6-(1,3-oxazol-2-ylsulfanylmethyl)benzoic acid |
|---|---|
| PubChem CID | 106920733 |
| Molecular Formula | C11H8N2O5S |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 2-nitro-6-(1,3-oxazol-2-ylsulfanylmethyl)benzoic acid |
| SMILES | O=C(O)c1c(CSc2ncco2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H8N2O5S/c14-10(15)9-7(2-1-3-8(9)13(16)17)6-19-11-12-4-5-18-11/h1-5H,6H2,(H,14,15) |
| InChIKey | IFHFIKYVIJDORR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 106.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|