C9H5N3O5S — CID 106921062
5-nitro-6-(1,3-oxazol-2-ylsulfanyl)pyridine-2-carboxylic acid (PubChem CID 106921062) has the molecular formula C9H5N3O5S and a molecular weight of 267.22 g/mol. Its IUPAC name is 5-nitro-6-(1,3-oxazol-2-ylsulfanyl)pyridine-2-carboxylic acid.
| Compound Name | 5-nitro-6-(1,3-oxazol-2-ylsulfanyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 106921062 |
| Molecular Formula | C9H5N3O5S |
| Molecular Weight | 267.22 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | 5-nitro-6-(1,3-oxazol-2-ylsulfanyl)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])c(Sc2ncco2)n1 |
| InChI | InChI=1S/C9H5N3O5S/c13-8(14)5-1-2-6(12(15)16)7(11-5)18-9-10-3-4-17-9/h1-4H,(H,13,14) |
| InChIKey | HXWNHYIOOYOZAF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|