C9H6N2O3S — CID 106921080
5-(1,3-oxazol-2-ylsulfanyl)pyridine-2-carboxylic acid (PubChem CID 106921080) has the molecular formula C9H6N2O3S and a molecular weight of 222.23 g/mol. Its IUPAC name is 5-(1,3-oxazol-2-ylsulfanyl)pyridine-2-carboxylic acid.
| Compound Name | 5-(1,3-oxazol-2-ylsulfanyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 106921080 |
| Molecular Formula | C9H6N2O3S |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.01 |
| IUPAC Name | 5-(1,3-oxazol-2-ylsulfanyl)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(Sc2ncco2)cn1 |
| InChI | InChI=1S/C9H6N2O3S/c12-8(13)7-2-1-6(5-11-7)15-9-10-3-4-14-9/h1-5H,(H,12,13) |
| InChIKey | JIQUUEUSYIJDHZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |