About 5-(1,3-oxazol-2-ylsulfanyl)pyridine-2-carbonitrile
5-(1,3-oxazol-2-ylsulfanyl)pyridine-2-carbonitrile (PubChem CID 106922375) has the molecular formula C9H5N3OS
and a molecular weight of 203.23 g/mol. Its IUPAC name is 5-(1,3-oxazol-2-ylsulfanyl)pyridine-2-carbonitrile.
Analyze 5-(1,3-oxazol-2-ylsulfanyl)pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-oxazol-2-ylsulfanyl)pyridine-2-carbonitrile?
The IUPAC name of 5-(1,3-oxazol-2-ylsulfanyl)pyridine-2-carbonitrile (CID 106922375) is 5-(1,3-oxazol-2-ylsulfanyl)pyridine-2-carbonitrile.
What is the SMILES notation for 5-(1,3-oxazol-2-ylsulfanyl)pyridine-2-carbonitrile?
The canonical SMILES for 5-(1,3-oxazol-2-ylsulfanyl)pyridine-2-carbonitrile is N#Cc1ccc(Sc2ncco2)cn1.
What is the InChIKey of 5-(1,3-oxazol-2-ylsulfanyl)pyridine-2-carbonitrile?
The InChIKey is WAPCMTGKRPJDMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5N3OS/c10-5-7-1-2-8(6-12-7)14-9-11-3-4-13-9/h1-4,6H.
What are the key properties of 5-(1,3-oxazol-2-ylsulfanyl)pyridine-2-carbonitrile?
5-(1,3-oxazol-2-ylsulfanyl)pyridine-2-carbonitrile has a molecular weight of 203.23 g/mol, XLogP of 2.09, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-oxazol-2-ylsulfanyl)pyridine-2-carbonitrile is sourced from PubChem (CID 106922375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).