C10H6N4OS — CID 115489944
5-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]pyridine-2-carbonitrile (PubChem CID 115489944) has the molecular formula C10H6N4OS and a molecular weight of 230.25 g/mol. Its IUPAC name is 5-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]pyridine-2-carbonitrile.
| Compound Name | 5-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 115489944 |
| Molecular Formula | C10H6N4OS |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 5-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(Sc2nccc(=O)[nH]2)cn1 |
| InChI | InChI=1S/C10H6N4OS/c11-5-7-1-2-8(6-13-7)16-10-12-4-3-9(15)14-10/h1-4,6H,(H,12,14,15) |
| InChIKey | IHURRPOZEOYCCQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |